C27H28N3O3S+ — CID 153371495
(E)-2-cyano-3-[5-[6-(3,6-dihydro-2H-1,4-oxazin-4-ium-4-yl)naphthalen-2-yl]thiophen-2-yl]-N-(4-hydroxy-2-methylbutan-2-yl)prop-2-enamide (PubChem CID 153371495) has the molecular formula C27H28N3O3S+ and a molecular weight of 474.61 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[6-(3,6-dihydro-2H-1,4-oxazin-4-ium-4-yl)naphthalen-2-yl]thiophen-2-yl]-N-(4-hydroxy-2-methylbutan-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[6-(3,6-dihydro-2H-1,4-oxazin-4-ium-4-yl)naphthalen-2-yl]thiophen-2-yl]-N-(4-hydroxy-2-methylbutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 153371495 |
| Molecular Formula | C27H28N3O3S+ |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (E)-2-cyano-3-[5-[6-(3,6-dihydro-2H-1,4-oxazin-4-ium-4-yl)naphthalen-2-yl]thiophen-2-yl]-N-(4-hydroxy-2-methylbutan-2-yl)prop-2-enamide |
| SMILES | CC(C)(CCO)NC(=O)/C(C#N)=C/c1ccc(-c2ccc3cc([N+]4=CCOCC4)ccc3c2)s1 |
| InChI | InChI=1S/C27H27N3O3S/c1-27(2,9-12-31)29-26(32)22(18-28)17-24-7-8-25(34-24)21-4-3-20-16-23(6-5-19(20)15-21)30-10-13-33-14-11-30/h3-8,10,15-17,31H,9,11-14H2,1-2H3/p+1/b22-17+ |
| InChIKey | HVEAFERPNLZEEY-OQKWZONESA-O |
| XLogP | 4.50 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|