C26H25N3OS — CID 145041366
ethane;4-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]pyridine-3-carbonitrile (PubChem CID 145041366) has the molecular formula C26H25N3OS and a molecular weight of 427.57 g/mol. Its IUPAC name is ethane;4-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]pyridine-3-carbonitrile.
| Compound Name | ethane;4-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 145041366 |
| Molecular Formula | C26H25N3OS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | ethane;4-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]pyridine-3-carbonitrile |
| SMILES | CC.N#Cc1cnccc1-c1ccc(-c2ccc3cc(N4CCOCC4)ccc3c2)s1 |
| InChI | InChI=1S/C24H19N3OS.C2H6/c25-15-20-16-26-8-7-22(20)24-6-5-23(29-24)19-2-1-18-14-21(4-3-17(18)13-19)27-9-11-28-12-10-27;1-2/h1-8,13-14,16H,9-12H2;1-2H3 |
| InChIKey | NIFHUCGAVTXLDK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |