About 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile
3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile (PubChem CID 164853087) has the molecular formula C19H18N4O3
and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile |
| PubChem CID | 164853087 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccncc1N1CCOc2cc(N3CCOCC3)ccc2C1=O |
| InChI | InChI=1S/C19H18N4O3/c20-12-14-3-4-21-13-17(14)23-7-10-26-18-11-15(1-2-16(18)19(23)24)22-5-8-25-9-6-22/h1-4,11,13H,5-10H2 |
| InChIKey | LDKUXRHJZKWGOO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile?
The IUPAC name of 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile (CID 164853087) is 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile.
What is the SMILES notation for 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile?
The canonical SMILES for 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile is N#Cc1ccncc1N1CCOc2cc(N3CCOCC3)ccc2C1=O.
What is the InChIKey of 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile?
The InChIKey is LDKUXRHJZKWGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O3/c20-12-14-3-4-21-13-17(14)23-7-10-26-18-11-15(1-2-16(18)19(23)24)22-5-8-25-9-6-22/h1-4,11,13H,5-10H2.
What are the key properties of 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile?
3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile has a molecular weight of 350.38 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-morpholin-4-yl-5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)pyridine-4-carbonitrile is sourced from PubChem (CID 164853087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).