C33H46N4O4S — CID 145041258
(E)-2-aminosulfanyl-3-[1-methyl-5-[6-[pentyl(propyl)amino]naphthalen-2-yl]pyrrol-2-yl]but-2-enenitrile;6-(hydroxymethyl)oxane-2,4-diol (PubChem CID 145041258) has the molecular formula C33H46N4O4S and a molecular weight of 594.82 g/mol. Its IUPAC name is (E)-2-aminosulfanyl-3-[1-methyl-5-[6-[pentyl(propyl)amino]naphthalen-2-yl]pyrrol-2-yl]but-2-enenitrile;6-(hydroxymethyl)oxane-2,4-diol.
| Compound Name | (E)-2-aminosulfanyl-3-[1-methyl-5-[6-[pentyl(propyl)amino]naphthalen-2-yl]pyrrol-2-yl]but-2-enenitrile;6-(hydroxymethyl)oxane-2,4-diol |
|---|---|
| PubChem CID | 145041258 |
| Molecular Formula | C33H46N4O4S |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (E)-2-aminosulfanyl-3-[1-methyl-5-[6-[pentyl(propyl)amino]naphthalen-2-yl]pyrrol-2-yl]but-2-enenitrile;6-(hydroxymethyl)oxane-2,4-diol |
| SMILES | CCCCCN(CCC)c1ccc2cc(-c3ccc(/C(C)=C(\C#N)SN)n3C)ccc2c1.OCC1CC(O)CC(O)O1 |
| InChI | InChI=1S/C27H34N4S.C6H12O4/c1-5-7-8-16-31(15-6-2)24-12-11-21-17-23(10-9-22(21)18-24)26-14-13-25(30(26)4)20(3)27(19-28)32-29;7-3-5-1-4(8)2-6(9)10-5/h9-14,17-18H,5-8,15-16,29H2,1-4H3;4-9H,1-3H2/b27-20+; |
| InChIKey | LOCNULMUOJZWQF-PQAWYCKWSA-N |
| XLogP | 5.95 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|