C31H37N3O — CID 153371591
(2Z,4Z)-2-[(E)-but-1-enyl]-3-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]hexa-2,4-dienenitrile;ethane (PubChem CID 153371591) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is (2Z,4Z)-2-[(E)-but-1-enyl]-3-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]hexa-2,4-dienenitrile;ethane.
| Compound Name | (2Z,4Z)-2-[(E)-but-1-enyl]-3-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]hexa-2,4-dienenitrile;ethane |
|---|---|
| PubChem CID | 153371591 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (2Z,4Z)-2-[(E)-but-1-enyl]-3-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]hexa-2,4-dienenitrile;ethane |
| SMILES | C/C=C\C(=C(C#N)/C=C/CC)c1ccc(-c2ccc3cc(N4CCN(C)CC4)ccc3c2)o1.CC |
| InChI | InChI=1S/C29H31N3O.C2H6/c1-4-6-8-25(21-30)27(7-5-2)29-14-13-28(33-29)24-10-9-23-20-26(12-11-22(23)19-24)32-17-15-31(3)16-18-32;1-2/h5-14,19-20H,4,15-18H2,1-3H3;1-2H3/b7-5-,8-6+,27-25-; |
| InChIKey | DDUJJKRKWZEHRK-BAMSHPHWSA-N |
| XLogP | 7.70 |
| TPSA | 43.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|