C26H40N4O6 — CID 166868697
(E)-2-cyano-3-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(5-hydroxypentoxy)hexyl]prop-2-enamide (PubChem CID 166868697) has the molecular formula C26H40N4O6 and a molecular weight of 504.63 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(5-hydroxypentoxy)hexyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(5-hydroxypentoxy)hexyl]prop-2-enamide |
|---|---|
| PubChem CID | 166868697 |
| Molecular Formula | C26H40N4O6 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | (E)-2-cyano-3-[4-(4-methylpiperazin-1-yl)phenyl]-N-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(5-hydroxypentoxy)hexyl]prop-2-enamide |
| SMILES | C[C@H](O)[C@@H](O)[C@H](O)[C@@H](CNC(=O)/C(C#N)=C/c1ccc(N2CCN(C)CC2)cc1)OCCCCCO |
| InChI | InChI=1S/C26H40N4O6/c1-19(32)24(33)25(34)23(36-15-5-3-4-14-31)18-28-26(35)21(17-27)16-20-6-8-22(9-7-20)30-12-10-29(2)11-13-30/h6-9,16,19,23-25,31-34H,3-5,10-15,18H2,1-2H3,(H,28,35)/b21-16+/t19-,23+,24+,25+/m0/s1 |
| InChIKey | IUHMOKCGTHXGPQ-BVJFYQENSA-N |
| XLogP | 0.11 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|