C22H24N2O4 — CID 166480717
(2E)-2-[1-[8-(aziridin-1-yl)naphthalen-2-yl]ethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile (PubChem CID 166480717) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2E)-2-[1-[8-(aziridin-1-yl)naphthalen-2-yl]ethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile.
| Compound Name | (2E)-2-[1-[8-(aziridin-1-yl)naphthalen-2-yl]ethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile |
|---|---|
| PubChem CID | 166480717 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2E)-2-[1-[8-(aziridin-1-yl)naphthalen-2-yl]ethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile |
| SMILES | C/C(=C(/C#N)C(=O)CCC(O)C(O)CO)c1ccc2cccc(N3CC3)c2c1 |
| InChI | InChI=1S/C22H24N2O4/c1-14(18(12-23)20(26)7-8-21(27)22(28)13-25)16-6-5-15-3-2-4-19(17(15)11-16)24-9-10-24/h2-6,11,21-22,25,27-28H,7-10,13H2,1H3/b18-14+ |
| InChIKey | OFICLOUOJUHLFD-NBVRZTHBSA-N |
| XLogP | 2.02 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|