C25H30N2O4 — CID 166480661
(2E)-6,7,8-trihydroxy-3-oxo-2-[1-(8-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile (PubChem CID 166480661) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is (2E)-6,7,8-trihydroxy-3-oxo-2-[1-(8-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile.
| Compound Name | (2E)-6,7,8-trihydroxy-3-oxo-2-[1-(8-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile |
|---|---|
| PubChem CID | 166480661 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (2E)-6,7,8-trihydroxy-3-oxo-2-[1-(8-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile |
| SMILES | C/C(=C(/C#N)C(=O)CCC(O)C(O)CO)c1ccc2cccc(N3CCCCC3)c2c1 |
| InChI | InChI=1S/C25H30N2O4/c1-17(21(15-26)23(29)10-11-24(30)25(31)16-28)19-9-8-18-6-5-7-22(20(18)14-19)27-12-3-2-4-13-27/h5-9,14,24-25,28,30-31H,2-4,10-13,16H2,1H3/b21-17+ |
| InChIKey | IOUOGUSBGHQVJD-HEHNFIMWSA-N |
| XLogP | 3.19 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|