About [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate
[8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate (PubChem CID 18967509) has the molecular formula C22H21ClN2O2
and a molecular weight of 380.88 g/mol. Its IUPAC name is [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate |
| PubChem CID | 18967509 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate |
| SMILES | CN1CCN(c2cccc3ccc(OC(=O)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C22H21ClN2O2/c1-24-11-13-25(14-12-24)21-4-2-3-16-7-10-19(15-20(16)21)27-22(26)17-5-8-18(23)9-6-17/h2-10,15H,11-14H2,1H3 |
| InChIKey | DMBPSYHETWIESC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate?
The IUPAC name of [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate (CID 18967509) is [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate.
What is the SMILES notation for [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate?
The canonical SMILES for [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate is CN1CCN(c2cccc3ccc(OC(=O)c4ccc(Cl)cc4)cc23)CC1.
What is the InChIKey of [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate?
The InChIKey is DMBPSYHETWIESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O2/c1-24-11-13-25(14-12-24)21-4-2-3-16-7-10-19(15-20(16)21)27-22(26)17-5-8-18(23)9-6-17/h2-10,15H,11-14H2,1H3.
What are the key properties of [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate?
[8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate has a molecular weight of 380.88 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(4-methylpiperazin-1-yl)naphthalen-2-yl] 4-chlorobenzoate is sourced from PubChem (CID 18967509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).