C17H18F3NO — CID 166536342
2,2,2-trifluoro-1-(6-piperidin-1-ylnaphthalen-2-yl)ethanol (PubChem CID 166536342) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(6-piperidin-1-ylnaphthalen-2-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(6-piperidin-1-ylnaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 166536342 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2,2,2-trifluoro-1-(6-piperidin-1-ylnaphthalen-2-yl)ethanol |
| SMILES | OC(c1ccc2cc(N3CCCCC3)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO/c18-17(19,20)16(22)14-5-4-13-11-15(7-6-12(13)10-14)21-8-2-1-3-9-21/h4-7,10-11,16,22H,1-3,8-9H2 |
| InChIKey | QCCBCDJLDIQDDG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |