About [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate
[2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate (PubChem CID 61485788) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate.
Molecular Properties
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate |
| PubChem CID | 61485788 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate |
| SMILES | COCCNC(=O)COC(=O)c1cccc(N)c1C |
| InChI | InChI=1S/C13H18N2O4/c1-9-10(4-3-5-11(9)14)13(17)19-8-12(16)15-6-7-18-2/h3-5H,6-8,14H2,1-2H3,(H,15,16) |
| InChIKey | PGVXDVOKUKJTTG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate?
The IUPAC name of [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate (CID 61485788) is [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate.
What is the SMILES notation for [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate?
The canonical SMILES for [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate is COCCNC(=O)COC(=O)c1cccc(N)c1C.
What is the InChIKey of [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate?
The InChIKey is PGVXDVOKUKJTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-9-10(4-3-5-11(9)14)13(17)19-8-12(16)15-6-7-18-2/h3-5H,6-8,14H2,1-2H3,(H,15,16).
What are the key properties of [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate?
[2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate has a molecular weight of 266.30 g/mol, XLogP of 0.50, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methoxyethylamino)-2-oxoethyl] 3-amino-2-methylbenzoate is sourced from PubChem (CID 61485788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).