C10H13NO4 — CID 162641574
(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) 2-aminobenzoate (PubChem CID 162641574) has the molecular formula C10H13NO4 and a molecular weight of 216.25 g/mol. Its IUPAC name is (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) 2-aminobenzoate.
| Compound Name | (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) 2-aminobenzoate |
|---|---|
| PubChem CID | 162641574 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) 2-aminobenzoate |
| SMILES | [2H]C([2H])(O)C([2H])(O)C([2H])([2H])OC(=O)c1ccccc1N |
| InChI | InChI=1S/C10H13NO4/c11-9-4-2-1-3-8(9)10(14)15-6-7(13)5-12/h1-4,7,12-13H,5-6,11H2/i5D2,6D2,7D |
| InChIKey | VHWSRELATOUTAG-VJPLVGRJSA-N |
| XLogP | -0.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|