C24H34O6 — CID 102042816
bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate (PubChem CID 102042816) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate.
| Compound Name | bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102042816 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate |
| SMILES | C=CCO[C@H](C)C[C@@H](C)OC(=O)c1ccccc1C(=O)O[C@H](C)C[C@@H](C)OCC=C |
| InChI | InChI=1S/C24H34O6/c1-7-13-27-17(3)15-19(5)29-23(25)21-11-9-10-12-22(21)24(26)30-20(6)16-18(4)28-14-8-2/h7-12,17-20H,1-2,13-16H2,3-6H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | CHLYOVUKIMOWHM-UAFMIMERSA-N |
| XLogP | 4.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|