About bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate
bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate (PubChem CID 102042816) has the molecular formula C24H34O6
and a molecular weight of 418.53 g/mol. Its IUPAC name is bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate |
| PubChem CID | 102042816 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate |
| SMILES | C=CCO[C@H](C)C[C@@H](C)OC(=O)c1ccccc1C(=O)O[C@H](C)C[C@@H](C)OCC=C |
| InChI | InChI=1S/C24H34O6/c1-7-13-27-17(3)15-19(5)29-23(25)21-11-9-10-12-22(21)24(26)30-20(6)16-18(4)28-14-8-2/h7-12,17-20H,1-2,13-16H2,3-6H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | CHLYOVUKIMOWHM-UAFMIMERSA-N |
| XLogP | 4.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate?
The IUPAC name of bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate (CID 102042816) is bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate.
What is the SMILES notation for bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate?
The canonical SMILES for bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate is C=CCO[C@H](C)C[C@@H](C)OC(=O)c1ccccc1C(=O)O[C@H](C)C[C@@H](C)OCC=C.
What is the InChIKey of bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate?
The InChIKey is CHLYOVUKIMOWHM-UAFMIMERSA-N. The full InChI is InChI=1S/C24H34O6/c1-7-13-27-17(3)15-19(5)29-23(25)21-11-9-10-12-22(21)24(26)30-20(6)16-18(4)28-14-8-2/h7-12,17-20H,1-2,13-16H2,3-6H3/t17-,18-,19-,20-/m1/s1.
What are the key properties of bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate?
bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate has a molecular weight of 418.53 g/mol, XLogP of 4.74, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2R,4R)-4-prop-2-enoxypentan-2-yl] benzene-1,2-dicarboxylate is sourced from PubChem (CID 102042816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).