About 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate
4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate (PubChem CID 154713368) has the molecular formula C21H24F2O2
and a molecular weight of 346.42 g/mol. Its IUPAC name is 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate |
| PubChem CID | 154713368 |
| Molecular Formula | C21H24F2O2 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate |
| SMILES | CC(C)CC(C)OC(=O)c1ccccc1C(F)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H24F2O2/c1-14(2)12-15(3)25-21(24)19-7-5-4-6-18(19)20(23)13-16-8-10-17(22)11-9-16/h4-11,14-15,20H,12-13H2,1-3H3 |
| InChIKey | MUQINPRDSLGBHK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate?
The IUPAC name of 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate (CID 154713368) is 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate.
What is the SMILES notation for 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate?
The canonical SMILES for 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate is CC(C)CC(C)OC(=O)c1ccccc1C(F)Cc1ccc(F)cc1.
What is the InChIKey of 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate?
The InChIKey is MUQINPRDSLGBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2O2/c1-14(2)12-15(3)25-21(24)19-7-5-4-6-18(19)20(23)13-16-8-10-17(22)11-9-16/h4-11,14-15,20H,12-13H2,1-3H3.
What are the key properties of 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate?
4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate has a molecular weight of 346.42 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl 2-[1-fluoro-2-(4-fluorophenyl)ethyl]benzoate is sourced from PubChem (CID 154713368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).