C18H22O6 — CID 69119506
bis(1-ethenoxypropan-2-yl) benzene-1,2-dicarboxylate (PubChem CID 69119506) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is bis(1-ethenoxypropan-2-yl) benzene-1,2-dicarboxylate.
| Compound Name | bis(1-ethenoxypropan-2-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69119506 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | bis(1-ethenoxypropan-2-yl) benzene-1,2-dicarboxylate |
| SMILES | C=COCC(C)OC(=O)c1ccccc1C(=O)OC(C)COC=C |
| InChI | InChI=1S/C18H22O6/c1-5-21-11-13(3)23-17(19)15-9-7-8-10-16(15)18(20)24-14(4)12-22-6-2/h5-10,13-14H,1-2,11-12H2,3-4H3 |
| InChIKey | IBLDPSDFLVBLFK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|