C22H30O8 — CID 69054041
3-[1-(5-carboxypentanoyloxy)-2,2,4-trimethylpentan-3-yl]oxycarbonylbenzoic acid (PubChem CID 69054041) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is 3-[1-(5-carboxypentanoyloxy)-2,2,4-trimethylpentan-3-yl]oxycarbonylbenzoic acid.
| Compound Name | 3-[1-(5-carboxypentanoyloxy)-2,2,4-trimethylpentan-3-yl]oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 69054041 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 3-[1-(5-carboxypentanoyloxy)-2,2,4-trimethylpentan-3-yl]oxycarbonylbenzoic acid |
| SMILES | CC(C)C(OC(=O)c1cccc(C(=O)O)c1)C(C)(C)COC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C22H30O8/c1-14(2)19(30-21(28)16-9-7-8-15(12-16)20(26)27)22(3,4)13-29-18(25)11-6-5-10-17(23)24/h7-9,12,14,19H,5-6,10-11,13H2,1-4H3,(H,23,24)(H,26,27) |
| InChIKey | WJWAGZWUXCUTIP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|