C28H46O13 — CID 90212421
[2-[[3-butanoyloxy-2,2-bis(butanoyloxymethyl)propoxy]methyl]-3-formyloxy-2-(formyloxymethyl)propyl] butanoate (PubChem CID 90212421) has the molecular formula C28H46O13 and a molecular weight of 590.66 g/mol. Its IUPAC name is [2-[[3-butanoyloxy-2,2-bis(butanoyloxymethyl)propoxy]methyl]-3-formyloxy-2-(formyloxymethyl)propyl] butanoate.
| Compound Name | [2-[[3-butanoyloxy-2,2-bis(butanoyloxymethyl)propoxy]methyl]-3-formyloxy-2-(formyloxymethyl)propyl] butanoate |
|---|---|
| PubChem CID | 90212421 |
| Molecular Formula | C28H46O13 |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | [2-[[3-butanoyloxy-2,2-bis(butanoyloxymethyl)propoxy]methyl]-3-formyloxy-2-(formyloxymethyl)propyl] butanoate |
| SMILES | CCCC(=O)OCC(COC=O)(COC=O)COCC(COC(=O)CCC)(COC(=O)CCC)COC(=O)CCC |
| InChI | InChI=1S/C28H46O13/c1-5-9-23(31)38-17-27(15-36-21-29,16-37-22-30)13-35-14-28(18-39-24(32)10-6-2,19-40-25(33)11-7-3)20-41-26(34)12-8-4/h21-22H,5-20H2,1-4H3 |
| InChIKey | GNGIJIZUQPWRMO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|