About 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride
3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride (PubChem CID 141395428) has the molecular formula C6H11Cl3N2O
and a molecular weight of 233.53 g/mol. Its IUPAC name is 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride.
Molecular Properties
| Compound Name | 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride |
| PubChem CID | 141395428 |
| Molecular Formula | C6H11Cl3N2O |
| Molecular Weight | 233.53 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\CCCl)O/C(CCCl)=N/[H] |
| InChI | InChI=1S/C6H10Cl2N2O.ClH/c7-3-1-5(9)11-6(10)2-4-8;/h9-10H,1-4H2;1H/b9-5+,10-6+; |
| InChIKey | CAZGKNWRSKJHPH-QJQFWQJTSA-N |
| XLogP | 2.64 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride?
The IUPAC name of 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride (CID 141395428) is 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride.
What is the SMILES notation for 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride?
The canonical SMILES for 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride is Cl.[H]/N=C(\CCCl)O/C(CCCl)=N/[H].
What is the InChIKey of 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride?
The InChIKey is CAZGKNWRSKJHPH-QJQFWQJTSA-N. The full InChI is InChI=1S/C6H10Cl2N2O.ClH/c7-3-1-5(9)11-6(10)2-4-8;/h9-10H,1-4H2;1H/b9-5+,10-6+;.
What are the key properties of 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride?
3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride has a molecular weight of 233.53 g/mol, XLogP of 2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropanimidoyl 3-chloropropanimidate;hydrochloride is sourced from PubChem (CID 141395428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).