C7H14N2O6S — CID 161444930
(2S)-2-aminobutanedioic acid;(2S)-2-amino-3-sulfanylpropanoic acid (PubChem CID 161444930) has the molecular formula C7H14N2O6S and a molecular weight of 254.26 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;(2S)-2-amino-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-aminobutanedioic acid;(2S)-2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 161444930 |
| Molecular Formula | C7H14N2O6S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;(2S)-2-amino-3-sulfanylpropanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.N[C@H](CS)C(=O)O |
| InChI | InChI=1S/C4H7NO4.C3H7NO2S/c5-2(4(8)9)1-3(6)7;4-2(1-7)3(5)6/h2H,1,5H2,(H,6,7)(H,8,9);2,7H,1,4H2,(H,5,6)/t2*2-/m01/s1 |
| InChIKey | VZTQVSLKNDYAGW-DEIFUSSXSA-N |
| XLogP | -1.80 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|