C8H16N2O2S — CID 90708080
(2R,5S)-2,5-diamino-6-methyl-1-sulfanylheptane-3,4-dione (PubChem CID 90708080) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is (2R,5S)-2,5-diamino-6-methyl-1-sulfanylheptane-3,4-dione.
| Compound Name | (2R,5S)-2,5-diamino-6-methyl-1-sulfanylheptane-3,4-dione |
|---|---|
| PubChem CID | 90708080 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2R,5S)-2,5-diamino-6-methyl-1-sulfanylheptane-3,4-dione |
| SMILES | CC(C)[C@H](N)C(=O)C(=O)[C@@H](N)CS |
| InChI | InChI=1S/C8H16N2O2S/c1-4(2)6(10)8(12)7(11)5(9)3-13/h4-6,13H,3,9-10H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | RGDVQYZNEMRSHA-WDSKDSINSA-N |
| XLogP | -0.63 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|