C10H21NO8S — CID 74947454
2-acetamido-3-sulfanylpropanoic acid;pentane-1,2,3,4,5-pentol (PubChem CID 74947454) has the molecular formula C10H21NO8S and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-acetamido-3-sulfanylpropanoic acid;pentane-1,2,3,4,5-pentol.
| Compound Name | 2-acetamido-3-sulfanylpropanoic acid;pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 74947454 |
| Molecular Formula | C10H21NO8S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-acetamido-3-sulfanylpropanoic acid;pentane-1,2,3,4,5-pentol |
| SMILES | CC(=O)NC(CS)C(=O)O.OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C5H9NO3S.C5H12O5/c1-3(7)6-4(2-10)5(8)9;6-1-3(8)5(10)4(9)2-7/h4,10H,2H2,1H3,(H,6,7)(H,8,9);3-10H,1-2H2 |
| InChIKey | PEZWDPDXQGIOTK-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|