C12H22N4O2 — CID 15723054
N-[2-[3-(2-acetamidoethylimino)butan-2-ylideneamino]ethyl]acetamide (PubChem CID 15723054) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-[2-[3-(2-acetamidoethylimino)butan-2-ylideneamino]ethyl]acetamide.
| Compound Name | N-[2-[3-(2-acetamidoethylimino)butan-2-ylideneamino]ethyl]acetamide |
|---|---|
| PubChem CID | 15723054 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-[2-[3-(2-acetamidoethylimino)butan-2-ylideneamino]ethyl]acetamide |
| SMILES | CC(=O)NCC/N=C(C)/C(C)=N/CCNC(C)=O |
| InChI | InChI=1S/C12H22N4O2/c1-9(13-5-7-15-11(3)17)10(2)14-6-8-16-12(4)18/h5-8H2,1-4H3,(H,15,17)(H,16,18)/b13-9+,14-10+ |
| InChIKey | OAKJONVUATZYNB-UTLPMFLDSA-N |
| XLogP | 0.18 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|