C14H23NO2S — CID 123386164
S-(2-acetamidoethyl) 2,5-dimethylocta-2,4-dienethioate (PubChem CID 123386164) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 2,5-dimethylocta-2,4-dienethioate.
| Compound Name | S-(2-acetamidoethyl) 2,5-dimethylocta-2,4-dienethioate |
|---|---|
| PubChem CID | 123386164 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | S-(2-acetamidoethyl) 2,5-dimethylocta-2,4-dienethioate |
| SMILES | CCCC(C)=CC=C(C)C(=O)SCCNC(C)=O |
| InChI | InChI=1S/C14H23NO2S/c1-5-6-11(2)7-8-12(3)14(17)18-10-9-15-13(4)16/h7-8H,5-6,9-10H2,1-4H3,(H,15,16) |
| InChIKey | YYPVEQRMSUZQLZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|