C10H18BrNO3S — CID 142008988
S-(2-acetamidoethyl) (3R)-5-bromo-3-hydroxy-2-methylpentanethioate (PubChem CID 142008988) has the molecular formula C10H18BrNO3S and a molecular weight of 312.23 g/mol. Its IUPAC name is S-(2-acetamidoethyl) (3R)-5-bromo-3-hydroxy-2-methylpentanethioate.
| Compound Name | S-(2-acetamidoethyl) (3R)-5-bromo-3-hydroxy-2-methylpentanethioate |
|---|---|
| PubChem CID | 142008988 |
| Molecular Formula | C10H18BrNO3S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | S-(2-acetamidoethyl) (3R)-5-bromo-3-hydroxy-2-methylpentanethioate |
| SMILES | CC(=O)NCCSC(=O)C(C)[C@H](O)CCBr |
| InChI | InChI=1S/C10H18BrNO3S/c1-7(9(14)3-4-11)10(15)16-6-5-12-8(2)13/h7,9,14H,3-6H2,1-2H3,(H,12,13)/t7?,9-/m1/s1 |
| InChIKey | UXZLQEDBFGLQMJ-NHSZFOGYSA-N |
| XLogP | 1.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|