C13H25NO3S — CID 101344649
S-[2-(propanoylamino)ethyl] (2R,3S)-3-hydroxy-2,5-dimethylhexanethioate (PubChem CID 101344649) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is S-[2-(propanoylamino)ethyl] (2R,3S)-3-hydroxy-2,5-dimethylhexanethioate.
| Compound Name | S-[2-(propanoylamino)ethyl] (2R,3S)-3-hydroxy-2,5-dimethylhexanethioate |
|---|---|
| PubChem CID | 101344649 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | S-[2-(propanoylamino)ethyl] (2R,3S)-3-hydroxy-2,5-dimethylhexanethioate |
| SMILES | CCC(=O)NCCSC(=O)[C@H](C)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C13H25NO3S/c1-5-12(16)14-6-7-18-13(17)10(4)11(15)8-9(2)3/h9-11,15H,5-8H2,1-4H3,(H,14,16)/t10-,11+/m1/s1 |
| InChIKey | RAPJMSITCPMKFR-MNOVXSKESA-N |
| XLogP | 1.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|