About 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate)
1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) (PubChem CID 158208620) has the molecular formula C15H25NO4S2
and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate).
Molecular Properties
| Compound Name | 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) |
| PubChem CID | 158208620 |
| Molecular Formula | C15H25NO4S2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) |
| SMILES | CCC(=O)CCCSC(=O)CCC(=O)SCCNC(=O)CC |
| InChI | InChI=1S/C15H25NO4S2/c1-3-12(17)6-5-10-21-14(19)7-8-15(20)22-11-9-16-13(18)4-2/h3-11H2,1-2H3,(H,16,18) |
| InChIKey | WJCYOGOZUQUPGJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate)?
The IUPAC name of 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) (CID 158208620) is 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate).
What is the SMILES notation for 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate)?
The canonical SMILES for 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) is CCC(=O)CCCSC(=O)CCC(=O)SCCNC(=O)CC.
What is the InChIKey of 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate)?
The InChIKey is WJCYOGOZUQUPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO4S2/c1-3-12(17)6-5-10-21-14(19)7-8-15(20)22-11-9-16-13(18)4-2/h3-11H2,1-2H3,(H,16,18).
What are the key properties of 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate)?
1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) has a molecular weight of 347.50 g/mol, XLogP of 2.57, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-S-(4-oxohexyl) 4-S-[2-(propanoylamino)ethyl] butanebis(thioate) is sourced from PubChem (CID 158208620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).