C11H23N5O3S — CID 158517948
methanamine;S-[2-(propanoylamino)ethyl] (2S,3S)-4-azido-3-hydroxy-2-methylbutanethioate (PubChem CID 158517948) has the molecular formula C11H23N5O3S and a molecular weight of 305.40 g/mol. Its IUPAC name is methanamine;S-[2-(propanoylamino)ethyl] (2S,3S)-4-azido-3-hydroxy-2-methylbutanethioate.
| Compound Name | methanamine;S-[2-(propanoylamino)ethyl] (2S,3S)-4-azido-3-hydroxy-2-methylbutanethioate |
|---|---|
| PubChem CID | 158517948 |
| Molecular Formula | C11H23N5O3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | methanamine;S-[2-(propanoylamino)ethyl] (2S,3S)-4-azido-3-hydroxy-2-methylbutanethioate |
| SMILES | CCC(=O)NCCSC(=O)[C@@H](C)[C@H](O)CN=[N+]=[N-].CN |
| InChI | InChI=1S/C10H18N4O3S.CH5N/c1-3-9(16)12-4-5-18-10(17)7(2)8(15)6-13-14-11;1-2/h7-8,15H,3-6H2,1-2H3,(H,12,16);2H2,1H3/t7-,8+;/m0./s1 |
| InChIKey | HLVZQXJJSIJRLF-KZYPOYLOSA-N |
| XLogP | 0.65 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|