About 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide
4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide (PubChem CID 160708013) has the molecular formula C10H20N4O4S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide.
Molecular Properties
| Compound Name | 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide |
| PubChem CID | 160708013 |
| Molecular Formula | C10H20N4O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide |
| SMILES | CC(C(=O)O)C(O)CN=[N+]=[N-].CCC(=O)NCCS |
| InChI | InChI=1S/C5H9N3O3.C5H11NOS/c1-3(5(10)11)4(9)2-7-8-6;1-2-5(7)6-3-4-8/h3-4,9H,2H2,1H3,(H,10,11);8H,2-4H2,1H3,(H,6,7) |
| InChIKey | RRMGSOPCLMALKF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 135.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide?
The IUPAC name of 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide (CID 160708013) is 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide.
What is the SMILES notation for 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide?
The canonical SMILES for 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide is CC(C(=O)O)C(O)CN=[N+]=[N-].CCC(=O)NCCS.
What is the InChIKey of 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide?
The InChIKey is RRMGSOPCLMALKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O3.C5H11NOS/c1-3(5(10)11)4(9)2-7-8-6;1-2-5(7)6-3-4-8/h3-4,9H,2H2,1H3,(H,10,11);8H,2-4H2,1H3,(H,6,7).
What are the key properties of 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide?
4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide has a molecular weight of 292.36 g/mol, XLogP of 0.82, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide is sourced from PubChem (CID 160708013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).