C10H20ClNO4S — CID 87985582
(2S,3R)-4-chloro-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide (PubChem CID 87985582) has the molecular formula C10H20ClNO4S and a molecular weight of 285.79 g/mol. Its IUPAC name is (2S,3R)-4-chloro-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide.
| Compound Name | (2S,3R)-4-chloro-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 87985582 |
| Molecular Formula | C10H20ClNO4S |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2S,3R)-4-chloro-3-hydroxy-2-methylbutanoic acid;N-(2-sulfanylethyl)propanamide |
| SMILES | CCC(=O)NCCS.C[C@H](C(=O)O)[C@@H](O)CCl |
| InChI | InChI=1S/C5H9ClO3.C5H11NOS/c1-3(5(8)9)4(7)2-6;1-2-5(7)6-3-4-8/h3-4,7H,2H2,1H3,(H,8,9);8H,2-4H2,1H3,(H,6,7)/t3-,4-;/m0./s1 |
| InChIKey | UYJMHECCYMBIKM-MMALYQPHSA-N |
| XLogP | 0.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|