C12H23NO4S — CID 87844216
3-hydroxy-2-methylhept-6-enoic acid;N-(2-sulfanylethyl)acetamide (PubChem CID 87844216) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-hydroxy-2-methylhept-6-enoic acid;N-(2-sulfanylethyl)acetamide.
| Compound Name | 3-hydroxy-2-methylhept-6-enoic acid;N-(2-sulfanylethyl)acetamide |
|---|---|
| PubChem CID | 87844216 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-hydroxy-2-methylhept-6-enoic acid;N-(2-sulfanylethyl)acetamide |
| SMILES | C=CCCC(O)C(C)C(=O)O.CC(=O)NCCS |
| InChI | InChI=1S/C8H14O3.C4H9NOS/c1-3-4-5-7(9)6(2)8(10)11;1-4(6)5-2-3-7/h3,6-7,9H,1,4-5H2,2H3,(H,10,11);7H,2-3H2,1H3,(H,5,6) |
| InChIKey | LKDRTUPJOHLYSA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|