About S-(2-acetamidoethyl) dec-2-enethioate
S-(2-acetamidoethyl) dec-2-enethioate (PubChem CID 3082094) has the molecular formula C14H25NO2S
and a molecular weight of 271.43 g/mol. Its IUPAC name is S-(2-acetamidoethyl) dec-2-enethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) dec-2-enethioate |
| PubChem CID | 3082094 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | S-(2-acetamidoethyl) dec-2-enethioate |
| SMILES | CCCCCCCC=CC(=O)SCCNC(C)=O |
| InChI | InChI=1S/C14H25NO2S/c1-3-4-5-6-7-8-9-10-14(17)18-12-11-15-13(2)16/h9-10H,3-8,11-12H2,1-2H3,(H,15,16) |
| InChIKey | HYDKTIAWESXLEF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) dec-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) dec-2-enethioate?
The IUPAC name of S-(2-acetamidoethyl) dec-2-enethioate (CID 3082094) is S-(2-acetamidoethyl) dec-2-enethioate.
What is the SMILES notation for S-(2-acetamidoethyl) dec-2-enethioate?
The canonical SMILES for S-(2-acetamidoethyl) dec-2-enethioate is CCCCCCCC=CC(=O)SCCNC(C)=O.
What is the InChIKey of S-(2-acetamidoethyl) dec-2-enethioate?
The InChIKey is HYDKTIAWESXLEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2S/c1-3-4-5-6-7-8-9-10-14(17)18-12-11-15-13(2)16/h9-10H,3-8,11-12H2,1-2H3,(H,15,16).
What are the key properties of S-(2-acetamidoethyl) dec-2-enethioate?
S-(2-acetamidoethyl) dec-2-enethioate has a molecular weight of 271.43 g/mol, XLogP of 3.30, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) dec-2-enethioate is sourced from PubChem (CID 3082094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).