C13H21N5O3 — CID 135190493
N-[(2Z,3E)-2-ethylidene-3-[(methyldiazenyl)carbamoylamino]hexa-3,5-dienoxy]propanamide (PubChem CID 135190493) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[(2Z,3E)-2-ethylidene-3-[(methyldiazenyl)carbamoylamino]hexa-3,5-dienoxy]propanamide.
| Compound Name | N-[(2Z,3E)-2-ethylidene-3-[(methyldiazenyl)carbamoylamino]hexa-3,5-dienoxy]propanamide |
|---|---|
| PubChem CID | 135190493 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(2Z,3E)-2-ethylidene-3-[(methyldiazenyl)carbamoylamino]hexa-3,5-dienoxy]propanamide |
| SMILES | C=C/C=C(NC(=O)N/N=N/C)\C(=C\C)CONC(=O)CC |
| InChI | InChI=1S/C13H21N5O3/c1-5-8-11(15-13(20)16-18-14-4)10(6-2)9-21-17-12(19)7-3/h5-6,8H,1,7,9H2,2-4H3,(H,17,19)(H2,14,15,16,20)/b10-6+,11-8+ |
| InChIKey | XVISTBKXWMXIRK-NSJFVGFPSA-N |
| XLogP | 1.76 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|