About N-butoxypropanamide
N-butoxypropanamide (PubChem CID 86250289) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is N-butoxypropanamide.
Molecular Properties
| Compound Name | N-butoxypropanamide |
| PubChem CID | 86250289 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | N-butoxypropanamide |
| SMILES | CCCCONC(=O)CC |
| InChI | InChI=1S/C7H15NO2/c1-3-5-6-10-8-7(9)4-2/h3-6H2,1-2H3,(H,8,9) |
| InChIKey | YTOSBHPLGATADD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butoxypropanamide?
The IUPAC name of N-butoxypropanamide (CID 86250289) is N-butoxypropanamide.
What is the SMILES notation for N-butoxypropanamide?
The canonical SMILES for N-butoxypropanamide is CCCCONC(=O)CC.
What is the InChIKey of N-butoxypropanamide?
The InChIKey is YTOSBHPLGATADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-3-5-6-10-8-7(9)4-2/h3-6H2,1-2H3,(H,8,9).
What are the key properties of N-butoxypropanamide?
N-butoxypropanamide has a molecular weight of 145.20 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butoxypropanamide is sourced from PubChem (CID 86250289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).