C15H17Cl2NO — CID 142178458
(2Z,3E)-3-(3,4-dichlorophenoxy)-2-ethylidene-N-methylhexa-3,5-dien-1-amine (PubChem CID 142178458) has the molecular formula C15H17Cl2NO and a molecular weight of 298.21 g/mol. Its IUPAC name is (2Z,3E)-3-(3,4-dichlorophenoxy)-2-ethylidene-N-methylhexa-3,5-dien-1-amine.
| Compound Name | (2Z,3E)-3-(3,4-dichlorophenoxy)-2-ethylidene-N-methylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142178458 |
| Molecular Formula | C15H17Cl2NO |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (2Z,3E)-3-(3,4-dichlorophenoxy)-2-ethylidene-N-methylhexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(Oc1ccc(Cl)c(Cl)c1)\C(=C/C)CNC |
| InChI | InChI=1S/C15H17Cl2NO/c1-4-6-15(11(5-2)10-18-3)19-12-7-8-13(16)14(17)9-12/h4-9,18H,1,10H2,2-3H3/b11-5-,15-6+ |
| InChIKey | TXHYFZYFFBFNFM-PGXQJWPDSA-N |
| XLogP | 4.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|