C17H22O3 — CID 144809326
(E)-1-(2,4-dihydroxyphenyl)-3-ethenyl-4-methyloct-3-en-1-one (PubChem CID 144809326) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-ethenyl-4-methyloct-3-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-ethenyl-4-methyloct-3-en-1-one |
|---|---|
| PubChem CID | 144809326 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-ethenyl-4-methyloct-3-en-1-one |
| SMILES | C=C/C(CC(=O)c1ccc(O)cc1O)=C(\C)CCCC |
| InChI | InChI=1S/C17H22O3/c1-4-6-7-12(3)13(5-2)10-16(19)15-9-8-14(18)11-17(15)20/h5,8-9,11,18,20H,2,4,6-7,10H2,1,3H3/b13-12- |
| InChIKey | PYYKGSSOTZVYHJ-SEYXRHQNSA-N |
| XLogP | 4.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|