C27H34O5 — CID 57243748
1-(2,4-dihydroxyphenyl)-3-[2-(3,7-dimethylocta-2,6-dienyl)-3,4-dimethoxyphenyl]propan-1-one (PubChem CID 57243748) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-[2-(3,7-dimethylocta-2,6-dienyl)-3,4-dimethoxyphenyl]propan-1-one.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-[2-(3,7-dimethylocta-2,6-dienyl)-3,4-dimethoxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 57243748 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-[2-(3,7-dimethylocta-2,6-dienyl)-3,4-dimethoxyphenyl]propan-1-one |
| SMILES | COc1ccc(CCC(=O)c2ccc(O)cc2O)c(CC=C(C)CCC=C(C)C)c1OC |
| InChI | InChI=1S/C27H34O5/c1-18(2)7-6-8-19(3)9-13-22-20(11-16-26(31-4)27(22)32-5)10-15-24(29)23-14-12-21(28)17-25(23)30/h7,9,11-12,14,16-17,28,30H,6,8,10,13,15H2,1-5H3 |
| InChIKey | RHAPTVWBAUZQRB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|