C18H30NO6P — CID 54439907
(2R)-3-phosphono-2-(3,7,11-trimethyldodeca-2,6,10-trienoylamino)propanoic acid (PubChem CID 54439907) has the molecular formula C18H30NO6P and a molecular weight of 387.41 g/mol. Its IUPAC name is (2R)-3-phosphono-2-(3,7,11-trimethyldodeca-2,6,10-trienoylamino)propanoic acid.
| Compound Name | (2R)-3-phosphono-2-(3,7,11-trimethyldodeca-2,6,10-trienoylamino)propanoic acid |
|---|---|
| PubChem CID | 54439907 |
| Molecular Formula | C18H30NO6P |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (2R)-3-phosphono-2-(3,7,11-trimethyldodeca-2,6,10-trienoylamino)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)N[C@@H](CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C18H30NO6P/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-17(20)19-16(18(21)22)12-26(23,24)25/h7,9,11,16H,5-6,8,10,12H2,1-4H3,(H,19,20)(H,21,22)(H2,23,24,25)/t16-/m0/s1 |
| InChIKey | WNJLAHFABBCSSD-INIZCTEOSA-N |
| XLogP | 3.15 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|