C19H29NO5 — CID 10473146
(2R)-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoyl]amino]butanedioic acid (PubChem CID 10473146) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is (2R)-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 10473146 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (2R)-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoyl]amino]butanedioic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H29NO5/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-17(21)20-16(19(24)25)12-18(22)23/h7,9,11,16H,5-6,8,10,12H2,1-4H3,(H,20,21)(H,22,23)(H,24,25)/b14-9+,15-11+/t16-/m1/s1 |
| InChIKey | GGAMAQNICRPPQT-PKZBUFLYSA-N |
| XLogP | 3.45 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|