C48H66N2O2S2 — CID 73057093
[4-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]piperazin-1-yl]-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphenyl]methanone (PubChem CID 73057093) has the molecular formula C48H66N2O2S2 and a molecular weight of 767.20 g/mol. Its IUPAC name is [4-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]piperazin-1-yl]-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphenyl]methanone.
| Compound Name | [4-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]piperazin-1-yl]-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphenyl]methanone |
|---|---|
| PubChem CID | 73057093 |
| Molecular Formula | C48H66N2O2S2 |
| Molecular Weight | 767.20 g/mol |
| Exact Mass | 766.46 |
| IUPAC Name | [4-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]piperazin-1-yl]-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphenyl]methanone |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccccc1C(=O)N1CCN(C(=O)c2ccccc2SC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C48H66N2O2S2/c1-37(2)17-13-19-39(5)21-15-23-41(7)29-35-53-45-27-11-9-25-43(45)47(51)49-31-33-50(34-32-49)48(52)44-26-10-12-28-46(44)54-36-30-42(8)24-16-22-40(6)20-14-18-38(3)4/h9-12,17-18,21-22,25-30H,13-16,19-20,23-24,31-36H2,1-8H3/b39-21+,40-22+,41-29+,42-30+ |
| InChIKey | WXRMSEZVUPWVQG-JLFQPTCLSA-N |
| XLogP | 13.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.20 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|