C26H40N2O2S — CID 73056469
N-[2-(2-aminoethoxy)ethyl]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide (PubChem CID 73056469) has the molecular formula C26H40N2O2S and a molecular weight of 444.69 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 73056469 |
| Molecular Formula | C26H40N2O2S |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccccc1C(=O)NCCOCCN |
| InChI | InChI=1S/C26H40N2O2S/c1-21(2)9-7-10-22(3)11-8-12-23(4)15-20-31-25-14-6-5-13-24(25)26(29)28-17-19-30-18-16-27/h5-6,9,11,13-15H,7-8,10,12,16-20,27H2,1-4H3,(H,28,29)/b22-11+,23-15+ |
| InChIKey | GKQVAHOHHRSPDB-RICZMCOPSA-N |
| XLogP | 5.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|