C38H50N2O5S — CID 78319741
[2-methoxy-4-[(E)-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]phenyl] 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate (PubChem CID 78319741) has the molecular formula C38H50N2O5S and a molecular weight of 646.89 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]phenyl] 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate.
| Compound Name | [2-methoxy-4-[(E)-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]phenyl] 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 78319741 |
| Molecular Formula | C38H50N2O5S |
| Molecular Weight | 646.89 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]phenyl] 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate |
| SMILES | COc1cc(/C=C/C(=O)NCCN2CCOCC2)ccc1OC(=O)c1ccccc1SC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C38H50N2O5S/c1-29(2)10-8-11-30(3)12-9-13-31(4)20-27-46-36-15-7-6-14-33(36)38(42)45-34-18-16-32(28-35(34)43-5)17-19-37(41)39-21-22-40-23-25-44-26-24-40/h6-7,10,12,14-20,28H,8-9,11,13,21-27H2,1-5H3,(H,39,41)/b19-17+,30-12+,31-20+ |
| InChIKey | SEUCMULGCFGTCV-BPFAZEAHSA-N |
| XLogP | 7.89 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.89 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|