C26H34N2O4 — CID 18227255
(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 18227255) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 18227255 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2ccc(CN3CCOCC3)cc2)ccc1OCC(C)C |
| InChI | InChI=1S/C26H34N2O4/c1-20(2)19-32-24-10-8-21(16-25(24)30-3)9-11-26(29)27-17-22-4-6-23(7-5-22)18-28-12-14-31-15-13-28/h4-11,16,20H,12-15,17-19H2,1-3H3,(H,27,29)/b11-9+ |
| InChIKey | YAWFGFYURJXTRM-PKNBQFBNSA-N |
| XLogP | 3.89 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|