C28H29N3O8 — CID 165402412
ethyl 2-[4-[[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]acetate (PubChem CID 165402412) has the molecular formula C28H29N3O8 and a molecular weight of 535.55 g/mol. Its IUPAC name is ethyl 2-[4-[[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 165402412 |
| Molecular Formula | C28H29N3O8 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | ethyl 2-[4-[[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(COc2ccc(/C=C/C(O)=C/C(=O)/C=C/c3ccc(O)c(OC)c3)cc2OC)nn1 |
| InChI | InChI=1S/C28H29N3O8/c1-4-38-28(35)17-31-16-21(29-30-31)18-39-25-12-8-20(14-27(25)37-3)6-10-23(33)15-22(32)9-5-19-7-11-24(34)26(13-19)36-2/h5-16,33-34H,4,17-18H2,1-3H3/b9-5+,10-6+,23-15- |
| InChIKey | DSABBKFOIKLPMO-BEYGKJMRSA-N |
| XLogP | 3.88 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|