C14H17N5O4 — CID 100830162
2-[[2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetyl]amino]acetamide (PubChem CID 100830162) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[[2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetyl]amino]acetamide.
| Compound Name | 2-[[2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 100830162 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[[2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetyl]amino]acetamide |
| SMILES | COc1ccccc1OCc1cn(CC(=O)NCC(N)=O)nn1 |
| InChI | InChI=1S/C14H17N5O4/c1-22-11-4-2-3-5-12(11)23-9-10-7-19(18-17-10)8-14(21)16-6-13(15)20/h2-5,7H,6,8-9H2,1H3,(H2,15,20)(H,16,21) |
| InChIKey | QSONYOXYEWMLNS-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |