C19H19FN4O3 — CID 100830961
N-[(4-fluorophenyl)methyl]-2-[4-[(4-methoxyphenoxy)methyl]triazol-1-yl]acetamide (PubChem CID 100830961) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-[(4-methoxyphenoxy)methyl]triazol-1-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-[(4-methoxyphenoxy)methyl]triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 100830961 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-[(4-methoxyphenoxy)methyl]triazol-1-yl]acetamide |
| SMILES | COc1ccc(OCc2cn(CC(=O)NCc3ccc(F)cc3)nn2)cc1 |
| InChI | InChI=1S/C19H19FN4O3/c1-26-17-6-8-18(9-7-17)27-13-16-11-24(23-22-16)12-19(25)21-10-14-2-4-15(20)5-3-14/h2-9,11H,10,12-13H2,1H3,(H,21,25) |
| InChIKey | AQBAMGXOZAMPOH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |