C17H17FN4O3 — CID 100830294
2-[4-[(4-fluorophenoxy)methyl]triazol-1-yl]-N-[2-(furan-2-yl)ethyl]acetamide (PubChem CID 100830294) has the molecular formula C17H17FN4O3 and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenoxy)methyl]triazol-1-yl]-N-[2-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[4-[(4-fluorophenoxy)methyl]triazol-1-yl]-N-[2-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 100830294 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[4-[(4-fluorophenoxy)methyl]triazol-1-yl]-N-[2-(furan-2-yl)ethyl]acetamide |
| SMILES | O=C(Cn1cc(COc2ccc(F)cc2)nn1)NCCc1ccco1 |
| InChI | InChI=1S/C17H17FN4O3/c18-13-3-5-16(6-4-13)25-12-14-10-22(21-20-14)11-17(23)19-8-7-15-2-1-9-24-15/h1-6,9-10H,7-8,11-12H2,(H,19,23) |
| InChIKey | XXJGVNUTAMRGGU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |