C20H20F2N4O2 — CID 119055203
2-[4-[(3-fluorophenoxy)methyl]triazol-1-yl]-N-[3-(2-fluorophenyl)propyl]acetamide (PubChem CID 119055203) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[4-[(3-fluorophenoxy)methyl]triazol-1-yl]-N-[3-(2-fluorophenyl)propyl]acetamide.
| Compound Name | 2-[4-[(3-fluorophenoxy)methyl]triazol-1-yl]-N-[3-(2-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 119055203 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[4-[(3-fluorophenoxy)methyl]triazol-1-yl]-N-[3-(2-fluorophenyl)propyl]acetamide |
| SMILES | O=C(Cn1cc(COc2cccc(F)c2)nn1)NCCCc1ccccc1F |
| InChI | InChI=1S/C20H20F2N4O2/c21-16-7-3-8-18(11-16)28-14-17-12-26(25-24-17)13-20(27)23-10-4-6-15-5-1-2-9-19(15)22/h1-3,5,7-9,11-12H,4,6,10,13-14H2,(H,23,27) |
| InChIKey | UCWHSMZRIVETRS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|