C16H22N4O3 — CID 100830183
N-[(2S)-butan-2-yl]-2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetamide (PubChem CID 100830183) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 100830183 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]acetamide |
| SMILES | CC[C@H](C)NC(=O)Cn1cc(COc2ccccc2OC)nn1 |
| InChI | InChI=1S/C16H22N4O3/c1-4-12(2)17-16(21)10-20-9-13(18-19-20)11-23-15-8-6-5-7-14(15)22-3/h5-9,12H,4,10-11H2,1-3H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | YDEMLALMPIGMDH-LBPRGKRZSA-N |
| XLogP | 1.78 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |