C12H14N4O3S — CID 115440701
4-[(5-thiophen-2-yltetrazol-1-yl)methyl]oxane-4-carboxylic acid (PubChem CID 115440701) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-[(5-thiophen-2-yltetrazol-1-yl)methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[(5-thiophen-2-yltetrazol-1-yl)methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115440701 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-[(5-thiophen-2-yltetrazol-1-yl)methyl]oxane-4-carboxylic acid |
| SMILES | O=C(O)C1(Cn2nnnc2-c2cccs2)CCOCC1 |
| InChI | InChI=1S/C12H14N4O3S/c17-11(18)12(3-5-19-6-4-12)8-16-10(13-14-15-16)9-2-1-7-20-9/h1-2,7H,3-6,8H2,(H,17,18) |
| InChIKey | NLQNKVLSLHPBGS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |