C12H13ClN4O3S — CID 115440752
4-[[5-(5-chlorothiophen-2-yl)tetrazol-1-yl]methyl]oxane-4-carboxylic acid (PubChem CID 115440752) has the molecular formula C12H13ClN4O3S and a molecular weight of 328.78 g/mol. Its IUPAC name is 4-[[5-(5-chlorothiophen-2-yl)tetrazol-1-yl]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[5-(5-chlorothiophen-2-yl)tetrazol-1-yl]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115440752 |
| Molecular Formula | C12H13ClN4O3S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-[[5-(5-chlorothiophen-2-yl)tetrazol-1-yl]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(O)C1(Cn2nnnc2-c2ccc(Cl)s2)CCOCC1 |
| InChI | InChI=1S/C12H13ClN4O3S/c13-9-2-1-8(21-9)10-14-15-16-17(10)7-12(11(18)19)3-5-20-6-4-12/h1-2H,3-7H2,(H,18,19) |
| InChIKey | BUOKDZUSFRFUMO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |